|
| Brand Name: | Chemfine |
| Model Number: | - |
| MOQ: | 25 Kg |
| Price: | USD 15-23 / Kilograms |
| Packaging Details: | 25kg fiber drum |
| Payment Terms: | L/C, T/T |
p-Phenylenediamine, also known as Ursol D, is one of the simplest aromatic diamines and a widely used intermediate. It is utilized in the production of azo dyes, polymer polymers, fur dyes, rubber antioxidants, photographic developers, and serves as a sensitive reagent for testing iron and copper. p-Phenylenediamine is a crucial dye intermediate, primarily employed in aramid fibers, azo dyes, sulfur dyes, acid dyes, and more.
| CAS | 106-50-3 |
| EINECS | 203-404-7 |
| Chemical Formula | C6H8N2 |
| Molecular Weight | 108.14 |
| InChI | InChI=1/C6H8N2/c7-5-1-2-6(8)4-3-5/h1-4H,7-8H2 |
| InChIKey | CBCKQZAAMUWICA-UHFFFAOYSA-N |
| Density | 1.135 g/cm3 (20℃) |
| Melting Point | 138-143 °C (lit.) |
| Boiling Point | 267 °C (lit.) |
| Flash Point | 156 °C |
| Water Solubility | 47 g/L (25 ºC) |
| Vapor Pressure | 1.08 mm Hg (100 °C) |
| Vapor Density | 3.7 (vs air) |
| Solubility | Soluble in ethanol, chloroform, ether, and hot benzene. |
| Refractive Index | 1.6339 (estimate) |
| Acidity Coefficient | 4.17 (at 25℃) |
| pH Value | 9 (50g/l, H2O, 20℃) |
| Storage Conditions | Store below +30°C. Stable, but oxidizes when exposed to air. Incompatible with oxidizing agents. Store under inert atmosphere. |
| Appearance | Powder or flakes |
| Color | White, gray, or purple to brown |
| Merck | 14,7285 |
| BRN | 742029 |
| Exposure Limit | TLV-TWA 0.1 mg/m3 (ACGIH 1989); TWAskin 0.1 mg/m3 (MSHA and OSHA); IDLH25 mg/m3 (NIOSH); carcinogenicity: Animal Inadequate Evidence (IARC). |
|
|
| Brand Name: | Chemfine |
| Model Number: | - |
| MOQ: | 25 Kg |
| Price: | USD 15-23 / Kilograms |
| Packaging Details: | 25kg fiber drum |
| Payment Terms: | L/C, T/T |
p-Phenylenediamine, also known as Ursol D, is one of the simplest aromatic diamines and a widely used intermediate. It is utilized in the production of azo dyes, polymer polymers, fur dyes, rubber antioxidants, photographic developers, and serves as a sensitive reagent for testing iron and copper. p-Phenylenediamine is a crucial dye intermediate, primarily employed in aramid fibers, azo dyes, sulfur dyes, acid dyes, and more.
| CAS | 106-50-3 |
| EINECS | 203-404-7 |
| Chemical Formula | C6H8N2 |
| Molecular Weight | 108.14 |
| InChI | InChI=1/C6H8N2/c7-5-1-2-6(8)4-3-5/h1-4H,7-8H2 |
| InChIKey | CBCKQZAAMUWICA-UHFFFAOYSA-N |
| Density | 1.135 g/cm3 (20℃) |
| Melting Point | 138-143 °C (lit.) |
| Boiling Point | 267 °C (lit.) |
| Flash Point | 156 °C |
| Water Solubility | 47 g/L (25 ºC) |
| Vapor Pressure | 1.08 mm Hg (100 °C) |
| Vapor Density | 3.7 (vs air) |
| Solubility | Soluble in ethanol, chloroform, ether, and hot benzene. |
| Refractive Index | 1.6339 (estimate) |
| Acidity Coefficient | 4.17 (at 25℃) |
| pH Value | 9 (50g/l, H2O, 20℃) |
| Storage Conditions | Store below +30°C. Stable, but oxidizes when exposed to air. Incompatible with oxidizing agents. Store under inert atmosphere. |
| Appearance | Powder or flakes |
| Color | White, gray, or purple to brown |
| Merck | 14,7285 |
| BRN | 742029 |
| Exposure Limit | TLV-TWA 0.1 mg/m3 (ACGIH 1989); TWAskin 0.1 mg/m3 (MSHA and OSHA); IDLH25 mg/m3 (NIOSH); carcinogenicity: Animal Inadequate Evidence (IARC). |
